Difference between revisions of "SALVPURINE2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuron...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * common-name: ** pyrazinamide * smiles: ** c1(n=cc=nc=1c(=o)n) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
+
** pyrazinamide
 
* smiles:
 
* smiles:
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
+
** c1(n=cc=nc=1c(=o)n)
 
* inchi-key:
 
* inchi-key:
** yyfgggcinngole-zdxogfqlsa-m
+
** ipehbumcgvemrf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 826.095
+
** 123.114
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PYRAZIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10607]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
+
{{#set: common-name=pyrazinamide}}
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
+
{{#set: inchi-key=inchikey=ipehbumcgvemrf-uhfffaoysa-n}}
{{#set: molecular-weight=826.095}}
+
{{#set: molecular-weight=123.114}}

Revision as of 14:18, 26 August 2019

Metabolite PYRAZINAMIDE

  • common-name:
    • pyrazinamide
  • smiles:
    • c1(n=cc=nc=1c(=o)n)
  • inchi-key:
    • ipehbumcgvemrf-uhfffaoysa-n
  • molecular-weight:
    • 123.114

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality