Difference between revisions of "SAM-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12677 CPD-12677] == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)...") |
|||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12677 CPD-12677] == | |
− | + | * common-name: | |
− | + | ** 5-chloro-5-deoxyribose 1-phosphate | |
− | + | * smiles: | |
− | + | ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) | |
− | + | * inchi-key: | |
− | + | ** dgviesznpvjdpq-soofdhnksa-l | |
− | }} | + | * molecular-weight: |
+ | ** 246.541 | ||
+ | == Reaction(s) known to consume the compound == | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11715]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}} | ||
+ | {{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}} | ||
+ | {{#set: molecular-weight=246.541}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-12677
- common-name:
- 5-chloro-5-deoxyribose 1-phosphate
- smiles:
- c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
- inchi-key:
- dgviesznpvjdpq-soofdhnksa-l
- molecular-weight:
- 246.541