Difference between revisions of "SAM-PWY"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12677 CPD-12677] ==
+== Pathway PWY-5407 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 5-chloro-5-deoxyribose 1-phosphate
+** 9-lipoxygenase and 9-allene oxide synthase pathway
-* smiles:
+== Reaction(s) found ==
-** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
+* [[RXN-8497]]
-* inchi-key:
+== Reaction(s) not found ==
-** dgviesznpvjdpq-soofdhnksa-l
+* [NoneRXN-8500 RXN-8500]
-* molecular-weight:
+* [NoneRXN-8495 RXN-8495]
-** 246.541
+* [NoneRXN-8501 RXN-8501]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8499 RXN-8499]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[RXN-11715]]
+{{#set: common-name=9-lipoxygenase and 9-allene oxide synthase pathway}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=246.541}}