Difference between revisions of "SCOPOLETIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02880 == * transcription-direction: ** positive * right-end-position: ** 72520 * left-end-position: ** 50563 * centisome-position: ** 38.7878 =...") |
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite SCOPOLETIN == |
| − | * | + | * common-name: |
| − | ** | + | ** scopoletin |
| − | * | + | * smiles: |
| − | ** | + | ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** rodxrvnmmdrfik-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 192.171 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-14179]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=scopoletin}} | |
| − | + | {{#set: inchi-key=inchikey=rodxrvnmmdrfik-uhfffaoysa-n}} | |
| − | == | + | {{#set: molecular-weight=192.171}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite SCOPOLETIN
- common-name:
- scopoletin
- smiles:
- coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
- inchi-key:
- rodxrvnmmdrfik-uhfffaoysa-n
- molecular-weight:
- 192.171
