Difference between revisions of "SE-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17385 == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=...")
(Created page with "Category:metabolite == Metabolite SE-2 == * common-name: ** selenide * smiles: ** [se--] * inchi-key: ** hmubncuqsstaib-uhfffaoysa-n * molecular-weight: ** 78.96 == Reacti...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17385 ==
+
== Metabolite SE-2 ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** selenide
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** [se--]
 
* inchi-key:
 
* inchi-key:
** krifzirxaaithr-kwfbmmabsa-j
+
** hmubncuqsstaib-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 78.96
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16134]]
+
* [[2.7.9.3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16132]]
+
* [[SELENOCYSTEINE-LYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=selenide}}
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
+
{{#set: inchi-key=inchikey=hmubncuqsstaib-uhfffaoysa-n}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=78.96}}

Latest revision as of 11:14, 18 March 2021

Metabolite SE-2

  • common-name:
    • selenide
  • smiles:
    • [se--]
  • inchi-key:
    • hmubncuqsstaib-uhfffaoysa-n
  • molecular-weight:
    • 78.96

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality