Difference between revisions of "SECOLOGANIN-CPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
(Created page with "Category:metabolite == Metabolite SECOLOGANIN-CPD == * common-name: ** secologanin * smiles: ** c=c[ch]1(c(oc=c(c(=o)oc)[ch](cc=o)1)oc2(oc(co)c(o)c(o)c(o)2)) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SECOLOGANIN-CPD == |
* common-name: | * common-name: | ||
| − | ** | + | ** secologanin |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c[ch]1(c(oc=c(c(=o)oc)[ch](cc=o)1)oc2(oc(co)c(o)c(o)c(o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cskkdsfetglmsb-nrzpkykesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 388.371 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=secologanin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cskkdsfetglmsb-nrzpkykesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=388.371}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite SECOLOGANIN-CPD
- common-name:
- secologanin
- smiles:
- c=c[ch]1(c(oc=c(c(=o)oc)[ch](cc=o)1)oc2(oc(co)c(o)c(o)c(o)2))
- inchi-key:
- cskkdsfetglmsb-nrzpkykesa-n
- molecular-weight:
- 388.371
