Difference between revisions of "SELENOMETHIONINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13853 == * common-name: ** 8-oxo-dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inch...") |
(Created page with "Category:metabolite == Metabolite SELENOMETHIONINE == * common-name: ** seleno-l-methionine * smiles: ** c[se]ccc(c([o-])=o)[n+] * inchi-key: ** rjfayqiboagblc-bypyzucnsa-...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SELENOMETHIONINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** seleno-l-methionine |
* smiles: | * smiles: | ||
| − | ** c | + | ** c[se]ccc(c([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rjfayqiboagblc-bypyzucnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 196.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12730]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=seleno-l-methionine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rjfayqiboagblc-bypyzucnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=196.107}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite SELENOMETHIONINE
- common-name:
- seleno-l-methionine
- smiles:
- c[se]ccc(c([o-])=o)[n+]
- inchi-key:
- rjfayqiboagblc-bypyzucnsa-n
- molecular-weight:
- 196.107
