Difference between revisions of "SEPO3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9895 == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
(Created page with "Category:metabolite == Metabolite SEPO3 == * common-name: ** selenophosphate * smiles: ** [o-]p([o-])(o)=[se] * inchi-key: ** jrphgdyskgjtkz-uhfffaoysa-l * molecular-weigh...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9895 ==
+
== Metabolite SEPO3 ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
+
** selenophosphate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
+
** [o-]p([o-])(o)=[se]
 
* inchi-key:
 
* inchi-key:
** hgwugdiatlopbn-bhzqgfrmsa-m
+
** jrphgdyskgjtkz-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 834.296
+
** 158.94
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9282]]
+
* [[RXN-10039]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.9.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}}
+
{{#set: common-name=selenophosphate}}
{{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}}
+
{{#set: inchi-key=inchikey=jrphgdyskgjtkz-uhfffaoysa-l}}
{{#set: molecular-weight=834.296}}
+
{{#set: molecular-weight=158.94}}

Latest revision as of 11:14, 18 March 2021

Metabolite SEPO3

  • common-name:
    • selenophosphate
  • smiles:
    • [o-]p([o-])(o)=[se]
  • inchi-key:
    • jrphgdyskgjtkz-uhfffaoysa-l
  • molecular-weight:
    • 158.94

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality