Difference between revisions of "SERDEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** c...")
(Created page with "Category:pathway == Pathway SERDEG-PWY == * taxonomic-range: ** tax-4751 ** tax-33208 ** tax-2 * common-name: ** l-serine degradation == Reaction(s) found == * RXN-15125...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] ==
+
== Pathway SERDEG-PWY ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-33208
 +
** tax-2
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl bacteriopheophytin
+
** l-serine degradation
* smiles:
+
== Reaction(s) found ==
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+
* [[RXN-15125]]
* inchi-key:
+
== Reaction(s) not found ==
** fzuvlshmhogmop-xqjlcrkzsa-n
+
* [NoneRXN-15127 RXN-15127]
* molecular-weight:
+
* [NoneRXN-15124 RXN-15124]
** 884.189
+
{{#set: taxonomic-range=tax-4751|tax-33208|tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-serine degradation}}
* [[RXN-8795]]
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.33}}
* [[RXN-8794]]
+
{{#set: nb total reaction=3}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
 
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
 
{{#set: molecular-weight=884.189}}
 

Latest revision as of 10:58, 18 March 2021

Pathway SERDEG-PWY

  • taxonomic-range:
    • tax-4751
    • tax-33208
    • tax-2
  • common-name:
    • l-serine degradation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-15127 RXN-15127]
  • [NoneRXN-15124 RXN-15124]