Difference between revisions of "SERDEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-557 CPD-557] == * common-name: ** a protein-nω-(adp-d-ribosyl)-l-arginine == Reaction...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-557 CPD-557] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] ==
 
* common-name:
 
* common-name:
** a protein-nω-(adp-d-ribosyl)-l-arginine
+
** dihydrogeranylgeranyl bacteriopheophytin
 +
* smiles:
 +
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 +
* inchi-key:
 +
** fzuvlshmhogmop-xqjlcrkzsa-n
 +
* molecular-weight:
 +
** 884.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.2.31-RXN]]
+
* [[RXN-8795]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.2.31-RXN]]
+
* [[RXN-8794]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a protein-nω-(adp-d-ribosyl)-l-arginine}}
+
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
 +
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
 +
{{#set: molecular-weight=884.189}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-9099

  • common-name:
    • dihydrogeranylgeranyl bacteriopheophytin
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • fzuvlshmhogmop-xqjlcrkzsa-n
  • molecular-weight:
    • 884.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality