Difference between revisions of "SERDEG-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9099 CPD-9099] ==
+== Pathway PWY3DJ-35471 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** dihydrogeranylgeranyl bacteriopheophytin
+** l-ascorbate biosynthesis iv
-* smiles:
+== Reaction(s) found ==
-** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+* [[GLUCURONATE-REDUCTASE-RXN]]
-* inchi-key:
+* [[L-GULONOLACTONE-OXIDASE-RXN]]
-** fzuvlshmhogmop-xqjlcrkzsa-n
+* [[RXN-8783]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 884.189
+* [NoneRXN-14693 RXN-14693]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8784 RXN-8784]
-* [[RXN-8795]]
+* [NoneRXN3DJ-64 RXN3DJ-64]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-7742}}
-* [[RXN-8794]]
+{{#set: common-name=l-ascorbate biosynthesis iv}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=3}}
-{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
+{{#set: completion rate=0.5}}
-{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=884.189}}