Difference between revisions of "SERDEG-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+== Pathway SERDEG-PWY ==
+* taxonomic-range:
+** tax-4751
+** tax-33208
+** tax-2
 * common-name:
-** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
+** l-serine degradation
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-15125]]
-* inchi-key:
+== Reaction(s) not found ==
-** jlhullpftgligf-dbyuabgnsa-j
+* [NoneRXN-15127 RXN-15127]
-* molecular-weight:
+* [NoneRXN-15124 RXN-15124]
-** 1051.975
+{{#set: taxonomic-range=tax-4751|tax-33208|tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-serine degradation}}
-* [[RXN-16097]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[RXN-16096]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
-{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
-{{#set: molecular-weight=1051.975}}