Difference between revisions of "SERDEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-557 CPD-557] == * common-name: ** a protein-nω-(adp-d-ribosyl)-l-arginine == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-557 CPD-557] ==
 
* common-name:
 
* common-name:
−
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
+
** a protein-nω-(adp-d-ribosyl)-l-arginine
−
* smiles:
 
−
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
−
* inchi-key:
 
−
** jlhullpftgligf-dbyuabgnsa-j
 
−
* molecular-weight:
 
−
** 1051.975
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16097]]
+
* [[2.4.2.31-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16096]]
+
* [[2.4.2.31-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
+
{{#set: common-name=a protein-nω-(adp-d-ribosyl)-l-arginine}}
−
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
 
−
{{#set: molecular-weight=1051.975}}
 

Revision as of 14:18, 26 August 2019

Metabolite CPD-557

  • common-name:
    • a protein-nω-(adp-d-ribosyl)-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SERDEG-PWY&oldid=13611"