Difference between revisions of "SEROTONIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...") |
(Created page with "Category:metabolite == Metabolite SEROTONIN == * common-name: ** serotonin * smiles: ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) * inchi-key: ** qzaygjvttncvmb-uhfffaoysa-o * mole...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SEROTONIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** serotonin |
* smiles: | * smiles: | ||
| − | ** c | + | ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qzaygjvttncvmb-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 177.225 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10777]] |
| + | * [[RXN-10778]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN3DJ-170]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=serotonin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qzaygjvttncvmb-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.225}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SEROTONIN
- common-name:
- serotonin
- smiles:
- c([n+])cc1(=cnc2(c=cc(o)=cc1=2))
- inchi-key:
- qzaygjvttncvmb-uhfffaoysa-o
- molecular-weight:
- 177.225
