Difference between revisions of "SHIKIMATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20814 == * transcription-direction: ** positive * right-end-position: ** 47241 * left-end-position: ** 14830 * centisome-position: ** 7.2954283...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite SHIKIMATE == |
| − | * | + | * common-name: |
| − | ** | + | ** shikimate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** jxohggnkmltubp-hsuxutppsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 173.145 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-7968]] |
| − | == Reaction(s) | + | * [[SHIKIMATE-KINASE-RXN]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | |
| − | + | * [[SHIKIMATE-KINASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=shikimate}} | |
| − | * [[ | + | {{#set: inchi-key=inchikey=jxohggnkmltubp-hsuxutppsa-m}} |
| − | + | {{#set: molecular-weight=173.145}} | |
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite SHIKIMATE
- common-name:
- shikimate
- smiles:
- c1(=c(cc(c(o)c(o)1)o)c(=o)[o-])
- inchi-key:
- jxohggnkmltubp-hsuxutppsa-m
- molecular-weight:
- 173.145
