Difference between revisions of "SHIKIMATE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9067 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * inchi-key: ** qyojs...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SHIKIMATE-5P == |
+ | * common-name: | ||
+ | ** shikimate 3-phosphate | ||
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) |
− | * | + | * inchi-key: |
− | ** | + | ** qyojskgcwnakgw-pbxrrbtrsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 251.109 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.5.1.19-RXN]] |
+ | * [[SHIKIMATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[2.5.1.19-RXN]] |
− | * [[RXN | + | * [[SHIKIMATE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=shikimate 3-phosphate}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}} |
+ | {{#set: molecular-weight=251.109}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite SHIKIMATE-5P
- common-name:
- shikimate 3-phosphate
- smiles:
- c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
- inchi-key:
- qyojskgcwnakgw-pbxrrbtrsa-k
- molecular-weight:
- 251.109