Difference between revisions of "SHIKIMATE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-611 == * common-name: ** thiamine triphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=n...")
(Created page with "Category:metabolite == Metabolite CPD-9067 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-611 ==
+
== Metabolite CPD-9067 ==
 +
* smiles:
 +
** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** thiamine triphosphate
+
** bacteriochlorophyll a
* smiles:
 
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
** iwlrowzyzpnofc-uhfffaoysa-k
 
 
* molecular-weight:
 
* molecular-weight:
** 501.26
+
** 910.51
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
+
* [[RXN-8791]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17426]]
 +
* [[RXN-8791]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine triphosphate}}
+
{{#set: common-name=bacteriochlorophyll a}}
{{#set: inchi-key=inchikey=iwlrowzyzpnofc-uhfffaoysa-k}}
+
{{#set: molecular-weight=910.51}}
{{#set: molecular-weight=501.26}}
 

Revision as of 15:28, 5 January 2021

Metabolite CPD-9067

  • smiles:
    • ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • bacteriochlorophyll a
  • molecular-weight:
    • 910.51

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality