Difference between revisions of "SINAPALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19487 == * common-name: ** 3-isopropyl-10-(methylthio)-2-oxodecanoate * smiles: ** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite Very-Long-Chain-3-Hydroxyacyl-CoAs == * common-name: ** a very-long-chain (3r)-3-hydroxyacyl-coa == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19487 ==
+
== Metabolite Very-Long-Chain-3-Hydroxyacyl-CoAs ==
 
* common-name:
 
* common-name:
** 3-isopropyl-10-(methylthio)-2-oxodecanoate
+
** a very-long-chain (3r)-3-hydroxyacyl-coa
* smiles:
 
** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** ukhzbtwecwuvph-uhfffaoysa-l
 
* molecular-weight:
 
** 274.331
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18200]]
+
* [[RXN-11750]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18200]]
+
* [[RXN-7698]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-isopropyl-10-(methylthio)-2-oxodecanoate}}
+
{{#set: common-name=a very-long-chain (3r)-3-hydroxyacyl-coa}}
{{#set: inchi-key=inchikey=ukhzbtwecwuvph-uhfffaoysa-l}}
 
{{#set: molecular-weight=274.331}}
 

Revision as of 11:13, 15 January 2021

Metabolite Very-Long-Chain-3-Hydroxyacyl-CoAs

  • common-name:
    • a very-long-chain (3r)-3-hydroxyacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality