Difference between revisions of "SINAPALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03911 == * transcription-direction: ** negative * right-end-position: ** 22186 * left-end-position: ** 9469 * centisome-position: ** 8.236134 =...")
 
(Created page with "Category:metabolite == Metabolite SINAPALDEHYDE == * common-name: ** sinapaldehyde * smiles: ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) * inchi-key: ** cdicdsogtrchmg-onegzznksa-n...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03911 ==
+
== Metabolite SINAPALDEHYDE ==
* transcription-direction:
+
* common-name:
** negative
+
** sinapaldehyde
* right-end-position:
+
* smiles:
** 22186
+
** coc1(c=c(c=cc=o)c=c(oc)c(o)=1)
* left-end-position:
+
* inchi-key:
** 9469
+
** cdicdsogtrchmg-onegzznksa-n
* centisome-position:
+
* molecular-weight:
** 8.236134   
+
** 208.213
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-1124]]
== Reaction(s) associated ==
+
* [[RXN-1125]]
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
* [[RXN-8014]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-1124]]
* [[UGD-RXN]]
+
* [[RXN-1143]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=sinapaldehyde}}
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=cdicdsogtrchmg-onegzznksa-n}}
* [[PWY-6073]]
+
{{#set: molecular-weight=208.213}}
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-6082]]
 
** '''3''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7346]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
* [[PWY-7820]]
 
** '''2''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=22186}}
 
{{#set: left-end-position=9469}}
 
{{#set: centisome-position=8.236134    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite SINAPALDEHYDE

  • common-name:
    • sinapaldehyde
  • smiles:
    • coc1(c=c(c=cc=o)c=c(oc)c(o)=1)
  • inchi-key:
    • cdicdsogtrchmg-onegzznksa-n
  • molecular-weight:
    • 208.213

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality