|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ21291 == | + | == Metabolite CPD-10254 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** (9z,12z)-hexadeca-9,12-dienoyl-coa |
| − | * right-end-position:
| + | * smiles: |
| − | ** 25239
| + | ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 6176 | + | ** cqxsjfxwargobe-pcrjdaltsa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 3.1721249 | + | ** 997.883 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) associated ==
| + | * [[RXN-9616]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[3-ISOPROPYLMALDEHYDROG-RXN]]
| + | {{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=997.883}} |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[IMDH]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-13158]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-14986]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-18200]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-18202]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-18204]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-18206]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-18208]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-18210]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-7745]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXNQT-4165]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXNQT-4168]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXNQT-4171]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXNQT-4174]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXNQT-4178]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[LEUSYN-PWY]]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6871]] | |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7396]]
| |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWYQT-4450]]
| |
| − | ** '''5''' reactions found over '''30''' reactions in the full pathway
| |
| − | * [[PWY-5101]]
| |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=25239}}
| |
| − | {{#set: left-end-position=6176}}
| |
| − | {{#set: centisome-position=3.1721249 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}} | |
| − | {{#set: nb reaction associated=16}}
| |
| − | {{#set: nb pathway associated=5}}
| |
