Difference between revisions of "SINAPALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD-14926 == * common-name: ** phytenal * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o * inchi-key: ** rafzysuicbqabu-pyddkjgssa-n * mol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10254 ==
+
== Metabolite CPD-14926 ==
 
* common-name:
 
* common-name:
** (9z,12z)-hexadeca-9,12-dienoyl-coa
+
** phytenal
 
* smiles:
 
* smiles:
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
 
* inchi-key:
 
* inchi-key:
** cqxsjfxwargobe-pcrjdaltsa-j
+
** rafzysuicbqabu-pyddkjgssa-n
 
* molecular-weight:
 
* molecular-weight:
** 997.883
+
** 294.52
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-479]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9616]]
+
* [[RXN66-478]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
+
{{#set: common-name=phytenal}}
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
+
{{#set: inchi-key=inchikey=rafzysuicbqabu-pyddkjgssa-n}}
{{#set: molecular-weight=997.883}}
+
{{#set: molecular-weight=294.52}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-14926

  • common-name:
    • phytenal
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
  • inchi-key:
    • rafzysuicbqabu-pyddkjgssa-n
  • molecular-weight:
    • 294.52

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality