Difference between revisions of "SINAPALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14926 == * common-name: ** phytenal * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o * inchi-key: ** rafzysuicbqabu-pyddkjgssa-n * mol...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE == * common-name: ** n-acetyl-9-o-acetylneuraminate * smiles: ** cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-9-o-acetylneuraminate |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)o)o)o))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nywzbrwkdrmpas-gyqvtdhrsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 350.302 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7864]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7864]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-9-o-acetylneuraminate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nywzbrwkdrmpas-gyqvtdhrsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=350.302}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE
- common-name:
- n-acetyl-9-o-acetylneuraminate
- smiles:
- cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)o)o)o))=o
- inchi-key:
- nywzbrwkdrmpas-gyqvtdhrsa-m
- molecular-weight:
- 350.302
