Difference between revisions of "SINAPATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-Methylcytosine-38-in-tRNAs == * common-name: ** a 5-methylcytosine38 in trna == Reaction(s) known to consume the compound == == Reactio...") |
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SINAPATE == |
* common-name: | * common-name: | ||
− | ** | + | ** sinapate |
+ | * smiles: | ||
+ | ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) | ||
+ | * inchi-key: | ||
+ | ** pcmortlopmlefb-onegzznksa-m | ||
+ | * molecular-weight: | ||
+ | ** 223.205 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10919]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-3422]] |
+ | * [[RXN-8014]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=sinapate}} |
+ | {{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}} | ||
+ | {{#set: molecular-weight=223.205}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SINAPATE
- common-name:
- sinapate
- smiles:
- coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
- inchi-key:
- pcmortlopmlefb-onegzznksa-m
- molecular-weight:
- 223.205