Difference between revisions of "SINAPATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D5-dodecenoyl-ACPs == * common-name: ** a (3e,5z)-dodeca-3,5-dienoyl-[acp] == Reaction(s) known to consume the compound == *...")
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D3-cis-D5-dodecenoyl-ACPs ==
+
== Metabolite SINAPATE ==
 
* common-name:
 
* common-name:
** a (3e,5z)-dodeca-3,5-dienoyl-[acp]
+
** sinapate
 +
* smiles:
 +
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
 +
* inchi-key:
 +
** pcmortlopmlefb-onegzznksa-m
 +
* molecular-weight:
 +
** 223.205
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2145]]
+
* [[RXN-10919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2144]]
+
* [[RXN-3422]]
 +
* [[RXN-8014]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3e,5z)-dodeca-3,5-dienoyl-[acp]}}
+
{{#set: common-name=sinapate}}
 +
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
 +
{{#set: molecular-weight=223.205}}

Latest revision as of 11:11, 18 March 2021

Metabolite SINAPATE

  • common-name:
    • sinapate
  • smiles:
    • coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
  • inchi-key:
    • pcmortlopmlefb-onegzznksa-m
  • molecular-weight:
    • 223.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality