Difference between revisions of "SINAPATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02661 == * transcription-direction: ** positive * right-end-position: ** 32357 * left-end-position: ** 24570 * centisome-position: ** 18.752863...")
 
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02661 ==
+
== Metabolite SINAPATE ==
* transcription-direction:
+
* common-name:
** positive
+
** sinapate
* right-end-position:
+
* smiles:
** 32357
+
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
* left-end-position:
+
* inchi-key:
** 24570
+
** pcmortlopmlefb-onegzznksa-m
* centisome-position:
+
* molecular-weight:
** 18.752863   
+
** 223.205
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10919]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-3422]]
* [[RXN-4210]]
+
* [[RXN-8014]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=sinapate}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=223.205}}
* [[RXN-707]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN66-27]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN66-323]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-2541]]
 
** '''11''' reactions found over '''35''' reactions in the full pathway
 
* [[PWY66-4]]
 
** '''14''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY66-341]]
 
** '''14''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY66-3]]
 
** '''12''' reactions found over '''18''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=32357}}
 
{{#set: left-end-position=24570}}
 
{{#set: centisome-position=18.752863    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite SINAPATE

  • common-name:
    • sinapate
  • smiles:
    • coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
  • inchi-key:
    • pcmortlopmlefb-onegzznksa-m
  • molecular-weight:
    • 223.205

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality