Difference between revisions of "SINAPOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00716 == * transcription-direction: ** negative * right-end-position: ** 288788 * left-end-position: ** 279084 * centisome-position: ** 49.43188...")
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00716 ==
+
== Metabolite SINAPOYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** sinapoyl-coa
−
* right-end-position:
+
* smiles:
−
** 288788
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 279084
+
** rbfuwesmwrugfy-gsnioflcsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 49.43188   
+
** 969.7
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-1124]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN-10919]]
−
** Category: [[annotation]]
+
* [[RXN-1124]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
{{#set: common-name=sinapoyl-coa}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=969.7}}
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=288788}}
 
−
{{#set: left-end-position=279084}}
 
−
{{#set: centisome-position=49.43188    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite SINAPOYL-COA

  • common-name:
    • sinapoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • rbfuwesmwrugfy-gsnioflcsa-j
  • molecular-weight:
    • 969.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SINAPOYL-COA&oldid=137321"