Difference between revisions of "SINAPOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12019 == * common-name: ** 5-methoxyindoleacetaldehyde * smiles: ** coc2(c=cc1(=c(c(cc=o)=cn1)c=2)) * inchi-key: ** xvhhcgdxcdkklh-uh...")
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12019 ==
+
== Metabolite SINAPOYL-COA ==
 
* common-name:
 
* common-name:
** 5-methoxyindoleacetaldehyde
+
** sinapoyl-coa
 
* smiles:
 
* smiles:
** coc2(c=cc1(=c(c(cc=o)=cn1)c=2))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** xvhhcgdxcdkklh-uhfffaoysa-n
+
** rbfuwesmwrugfy-gsnioflcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 189.213
+
** 969.7
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1124]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11067]]
+
* [[RXN-10919]]
 +
* [[RXN-1124]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methoxyindoleacetaldehyde}}
+
{{#set: common-name=sinapoyl-coa}}
{{#set: inchi-key=inchikey=xvhhcgdxcdkklh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}}
{{#set: molecular-weight=189.213}}
+
{{#set: molecular-weight=969.7}}

Latest revision as of 11:12, 18 March 2021

Metabolite SINAPOYL-COA

  • common-name:
    • sinapoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • rbfuwesmwrugfy-gsnioflcsa-j
  • molecular-weight:
    • 969.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality