Difference between revisions of "SINAPYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINAMARIN == * common-name: ** linamarin * smiles: ** cc(c)(c#n)oc1(oc(co)c(o)c(o)c(o)1) * inchi-key: ** qltchmyaejexbt-zebdfxrssa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-8978 == * common-name: ** ethylphosphate * smiles: ** ccop([o-])(=o)[o-] * inchi-key: ** zjxzsiysnxkhea-uhfffaoysa-l * molecular-weig...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8978 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ethylphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zjxzsiysnxkhea-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 124.033 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8748]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ethylphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zjxzsiysnxkhea-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=124.033}} |
Revision as of 08:23, 15 March 2021
Contents
Metabolite CPD-8978
- common-name:
- ethylphosphate
- smiles:
- ccop([o-])(=o)[o-]
- inchi-key:
- zjxzsiysnxkhea-uhfffaoysa-l
- molecular-weight:
- 124.033
