Difference between revisions of "SINAPYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-MANNOSYLCHITOBIO == * common-name: ** β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolichol == Re...") |
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=cco)c=c(oc)c(o)=1) * inchi-key: ** lzfopexouvtgjs-onegzznksa...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SINAPYL-ALCOHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** sinapyl alcohol |
| + | * smiles: | ||
| + | ** coc1(c=c(c=cco)c=c(oc)c(o)=1) | ||
| + | * inchi-key: | ||
| + | ** lzfopexouvtgjs-onegzznksa-n | ||
| + | * molecular-weight: | ||
| + | ** 210.229 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1125]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sinapyl alcohol}} |
| + | {{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}} | ||
| + | {{#set: molecular-weight=210.229}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SINAPYL-ALCOHOL
- common-name:
- sinapyl alcohol
- smiles:
- coc1(c=c(c=cco)c=c(oc)c(o)=1)
- inchi-key:
- lzfopexouvtgjs-onegzznksa-n
- molecular-weight:
- 210.229
