Difference between revisions of "SIROHYDROCHLORIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite L-arginyl-L-aspartyl-Peptides == * common-name: ** an n-terminal l-arginiyl-l-aspartyl-[protein] == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10712 ==
+
== Metabolite L-arginyl-L-aspartyl-Peptides ==
 
* common-name:
 
* common-name:
** di-trans, poly-cis-polyprenyl diphosphate (c80)
+
** an n-terminal l-arginiyl-l-aspartyl-[protein]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
** tunipipdjadhsr-hiqrjctmsa-k
 
* molecular-weight:
 
** 1264.842
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9969]]
+
* [[RXN-17889]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
+
{{#set: common-name=an n-terminal l-arginiyl-l-aspartyl-[protein]}}
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
 
{{#set: molecular-weight=1264.842}}
 

Revision as of 11:13, 15 January 2021

Metabolite L-arginyl-L-aspartyl-Peptides

  • common-name:
    • an n-terminal l-arginiyl-l-aspartyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-arginiyl-l-aspartyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.