Difference between revisions of "SIROHYDROCHLORIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10269 ==
+
== Metabolite SIROHYDROCHLORIN ==
 
* common-name:
 
* common-name:
** palmitoleoyl-coa
+
** sirohydrochlorin
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
 
* inchi-key:
 
* inchi-key:
** qbyoccwnzaoztl-mdmkaecgsa-j
+
** kwizrxmmfrbuml-ahgfgahvsa-f
 
* molecular-weight:
 
* molecular-weight:
** 999.899
+
** 854.779
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10662]]
+
* [[4.99.1.3-RXN]]
* [[RXN-17008]]
+
* [[SIROHEME-FERROCHELAT-RXN]]
* [[RXN-17009]]
 
* [[RXN-17019]]
 
* [[RXN-17788]]
 
* [[RXN-9616]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10664]]
+
* [[DIMETHUROPORDEHYDROG-RXN]]
* [[RXN-17787]]
 
* [[RXN0-7248]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleoyl-coa}}
+
{{#set: common-name=sirohydrochlorin}}
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
+
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
{{#set: molecular-weight=999.899}}
+
{{#set: molecular-weight=854.779}}

Latest revision as of 11:11, 18 March 2021

Metabolite SIROHYDROCHLORIN

  • common-name:
    • sirohydrochlorin
  • smiles:
    • cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
  • inchi-key:
    • kwizrxmmfrbuml-ahgfgahvsa-f
  • molecular-weight:
    • 854.779

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality