Difference between revisions of "SIROHYDROCHLORIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13866 == * transcription-direction: ** negative * right-end-position: ** 312314 * left-end-position: ** 310983 * centisome-position: ** 94.337616...") |
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SIROHYDROCHLORIN == |
− | * | + | * common-name: |
− | ** | + | ** sirohydrochlorin |
− | * | + | * smiles: |
− | ** | + | ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5))) |
− | * | + | * inchi-key: |
− | ** | + | ** kwizrxmmfrbuml-ahgfgahvsa-f |
− | * | + | * molecular-weight: |
− | ** | + | ** 854.779 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[4.99.1.3-RXN]] |
− | == Reaction(s) | + | * [[SIROHEME-FERROCHELAT-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[DIMETHUROPORDEHYDROG-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=sirohydrochlorin}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}} |
− | + | {{#set: molecular-weight=854.779}} | |
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SIROHYDROCHLORIN
- common-name:
- sirohydrochlorin
- smiles:
- cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
- inchi-key:
- kwizrxmmfrbuml-ahgfgahvsa-f
- molecular-weight:
- 854.779