Difference between revisions of "SIROHYDROCHLORIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13866 == * transcription-direction: ** negative * right-end-position: ** 312314 * left-end-position: ** 310983 * centisome-position: ** 94.337616...")
 
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ13866 ==
+
== Metabolite SIROHYDROCHLORIN ==
* transcription-direction:
+
* common-name:
** negative
+
** sirohydrochlorin
* right-end-position:
+
* smiles:
** 312314
+
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
* left-end-position:
+
* inchi-key:
** 310983
+
** kwizrxmmfrbuml-ahgfgahvsa-f
* centisome-position:
+
* molecular-weight:
** 94.337616   
+
** 854.779
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[4.99.1.3-RXN]]
== Reaction(s) associated ==
+
* [[SIROHEME-FERROCHELAT-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[DIMETHUROPORDEHYDROG-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
{{#set: transcription-direction=negative}}
+
{{#set: common-name=sirohydrochlorin}}
{{#set: right-end-position=312314}}
+
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
{{#set: left-end-position=310983}}
+
{{#set: molecular-weight=854.779}}
{{#set: centisome-position=94.337616    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite SIROHYDROCHLORIN

  • common-name:
    • sirohydrochlorin
  • smiles:
    • cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
  • inchi-key:
    • kwizrxmmfrbuml-ahgfgahvsa-f
  • molecular-weight:
    • 854.779

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality