Difference between revisions of "SIROHYDROCHLORIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14158 ==
+
== Metabolite SIROHYDROCHLORIN ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** sirohydrochlorin
 
* smiles:
 
* smiles:
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
+
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
 
* inchi-key:
 
* inchi-key:
** yppfejhohnpklt-pbsuhmdjsa-s
+
** kwizrxmmfrbuml-ahgfgahvsa-f
 
* molecular-weight:
 
* molecular-weight:
** 515.583
+
** 854.779
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[4.99.1.3-RXN]]
 +
* [[SIROHEME-FERROCHELAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
+
* [[DIMETHUROPORDEHYDROG-RXN]]
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=sirohydrochlorin}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
+
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
{{#set: molecular-weight=515.583}}
+
{{#set: molecular-weight=854.779}}

Latest revision as of 11:11, 18 March 2021

Metabolite SIROHYDROCHLORIN

  • common-name:
    • sirohydrochlorin
  • smiles:
    • cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
  • inchi-key:
    • kwizrxmmfrbuml-ahgfgahvsa-f
  • molecular-weight:
    • 854.779

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality