Difference between revisions of "SIROHYDROCHLORIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite SIROHYDROCHLORIN == |
* common-name: | * common-name: | ||
− | ** | + | ** sirohydrochlorin |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kwizrxmmfrbuml-ahgfgahvsa-f |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 854.779 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[4.99.1.3-RXN]] | ||
+ | * [[SIROHEME-FERROCHELAT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[DIMETHUROPORDEHYDROG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=sirohydrochlorin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=854.779}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite SIROHYDROCHLORIN
- common-name:
- sirohydrochlorin
- smiles:
- cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
- inchi-key:
- kwizrxmmfrbuml-ahgfgahvsa-f
- molecular-weight:
- 854.779