Difference between revisions of "SIROHYDROCHLORIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10269 ==
+
== Metabolite CPD-10712 ==
 
* common-name:
 
* common-name:
** palmitoleoyl-coa
+
** di-trans, poly-cis-polyprenyl diphosphate (c80)
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** qbyoccwnzaoztl-mdmkaecgsa-j
+
** tunipipdjadhsr-hiqrjctmsa-k
 
* molecular-weight:
 
* molecular-weight:
** 999.899
+
** 1264.842
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10662]]
 
* [[RXN-17008]]
 
* [[RXN-17009]]
 
* [[RXN-17019]]
 
* [[RXN-17788]]
 
* [[RXN-9616]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10664]]
+
* [[RXN-9969]]
* [[RXN-17787]]
 
* [[RXN0-7248]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleoyl-coa}}
+
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
+
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
{{#set: molecular-weight=999.899}}
+
{{#set: molecular-weight=1264.842}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-10712

  • common-name:
    • di-trans, poly-cis-polyprenyl diphosphate (c80)
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
  • inchi-key:
    • tunipipdjadhsr-hiqrjctmsa-k
  • molecular-weight:
    • 1264.842

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality