Difference between revisions of "SJ00037"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)...")
(Created page with "Category:gene == Gene SJ00037 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
+
== Gene SJ00037 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** 1d-myo-inositol 2-monophosphate
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1)
+
* [[PROTEIN-KINASE-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** inapmgsxuvuwaf-qwbqgljisa-l
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
** 258.121
+
{{#set: nb reaction associated=1}}
== Reaction(s) known to consume the compound ==
 
* [[RXN-7253]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=1d-myo-inositol 2-monophosphate}}
 
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-qwbqgljisa-l}}
 
{{#set: molecular-weight=258.121}}
 

Latest revision as of 11:04, 18 March 2021

Gene SJ00037

Organism(s) associated with this gene

Reaction(s) associated