Difference between revisions of "SJ00037"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14271 CPD-14271] == * common-name: ** 3-oxoicosanoyl-coa * smiles: ** cccccccccccccccccc(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14271 CPD-14271] ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 2-monophosphate
+
** 3-oxoicosanoyl-coa
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1)
+
** cccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** inapmgsxuvuwaf-qwbqgljisa-l
+
** fybvhnzjdvuvlj-ibyujnrcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 1072.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7253]]
+
* [[RXN-13298]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13294]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 2-monophosphate}}
+
{{#set: common-name=3-oxoicosanoyl-coa}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-qwbqgljisa-l}}
+
{{#set: inchi-key=inchikey=fybvhnzjdvuvlj-ibyujnrcsa-j}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=1072.006}}

Revision as of 09:25, 27 August 2019

Metabolite CPD-14271

  • common-name:
    • 3-oxoicosanoyl-coa
  • smiles:
    • cccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • fybvhnzjdvuvlj-ibyujnrcsa-j
  • molecular-weight:
    • 1072.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality