Difference between revisions of "SJ00052"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(...")
(Created page with "Category:gene == Gene SJ00052 == * transcription-direction: ** negative * right-end-position: ** 802690 * left-end-position: ** 780321 * centisome-position: ** 53.11721...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14392 CPD-14392] ==
+
== Gene SJ00052 ==
* common-name:
+
* transcription-direction:
** stearidonoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 802690
* inchi-key:
+
* left-end-position:
** ddhcsalwdprvcn-uswkvxsksa-j
+
** 780321
* molecular-weight:
+
* centisome-position:
** 1021.905
+
** 53.11721   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-13426]]
+
== Reaction(s) associated ==
* [[RXN-16041]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=stearidonoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
+
** Category: [[orthology]]
{{#set: molecular-weight=1021.905}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=802690}}
 +
{{#set: left-end-position=780321}}
 +
{{#set: centisome-position=53.11721    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ00052

  • transcription-direction:
    • negative
  • right-end-position:
    • 802690
  • left-end-position:
    • 780321
  • centisome-position:
    • 53.11721

Organism(s) associated with this gene

Reaction(s) associated