Difference between revisions of "SJ00082"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)scc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4184 CPD-4184] == * common-name: ** 4α-methyl-cholesta-8-enol * smiles: ** cc(c)cccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4184 CPD-4184] ==
 
* common-name:
 
* common-name:
** 4-cis-undecenoyl-coa
+
** 4α-methyl-cholesta-8-enol
 
* smiles:
 
* smiles:
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** afmmiiqkxqnedn-nsdzghcesa-j
+
** scezihjvtbqols-yijygbtnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 929.765
+
** 400.687
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14775]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14774]]
+
* [[RXN66-19]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-cis-undecenoyl-coa}}
+
{{#set: common-name=4α-methyl-cholesta-8-enol}}
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}}
+
{{#set: inchi-key=inchikey=scezihjvtbqols-yijygbtnsa-n}}
{{#set: molecular-weight=929.765}}
+
{{#set: molecular-weight=400.687}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-4184

  • common-name:
    • 4α-methyl-cholesta-8-enol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(o)cc3)))cc4)))c
  • inchi-key:
    • scezihjvtbqols-yijygbtnsa-n
  • molecular-weight:
    • 400.687

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality