Difference between revisions of "SJ00085"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl9-Nacetylglucosaminyl2 Mannosyl9-Nacetylglucosaminyl2] == == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl9-Nacetylglucosaminyl2 Mannosyl9-Nacetylglucosaminyl2] ==
* common-name:
 
** 7,8-diaminopelargonate
 
* smiles:
 
** cc(c(cccccc([o-])=o)[n+])[n+]
 
* inchi-key:
 
** kcegbpiygiwcdh-uhfffaoysa-o
 
* molecular-weight:
 
** 189.277
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAPASYN-RXN]]
+
* [[3.2.1.113-RXN]]
* [[DETHIOBIOTIN-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAPASYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-diaminopelargonate}}
 
{{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}}
 
{{#set: molecular-weight=189.277}}
 

Revision as of 14:19, 26 August 2019

Metabolite Mannosyl9-Nacetylglucosaminyl2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality