Difference between revisions of "SJ00160"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-CarboxyMeAmMe-2-O-MeU34-tRNALeu 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu] == * common-name: ** a 5-c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrogeranylgeranyl diphosphate |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** yjganofpasczbk-wcnzlwbosa-k | ||
| + | * molecular-weight: | ||
| + | ** 449.44 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7658]] | ||
| + | * [[RXN-7659]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7658]] |
| + | * [[RXN-7659]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrogeranylgeranyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}} | ||
| + | {{#set: molecular-weight=449.44}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-7002
- common-name:
- dihydrogeranylgeranyl diphosphate
- smiles:
- cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- yjganofpasczbk-wcnzlwbosa-k
- molecular-weight:
- 449.44
