Difference between revisions of "SJ00160"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STEARIC_ACID STEARIC_ACID] ==
 * common-name:
-** dihydrogeranylgeranyl diphosphate
+** stearate
 * smiles:
-** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
+** cccccccccccccccccc(=o)[o-]
 * inchi-key:
-** yjganofpasczbk-wcnzlwbosa-k
+** qiqxthqidytfrh-uhfffaoysa-m
 * molecular-weight:
-** 449.44
+** 283.473
 == Reaction(s) known to consume the compound ==
-* [[RXN-7658]]
+* [[RXN-11820-STEARIC_ACID/HYDROGEN-PEROXIDE//R-2-HYDROXYSTEARATE/WATER.58.]]
-* [[RXN-7659]]
+* [[RXN-16380]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-7658]]
+* [[LPLPS1AGPE180h]]
-* [[RXN-7659]]
+* [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]]
+* [[RXN-9548]]
+* [[RXN-9624]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dihydrogeranylgeranyl diphosphate}}
+{{#set: common-name=stearate}}
-{{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}}
+{{#set: inchi-key=inchikey=qiqxthqidytfrh-uhfffaoysa-m}}
-{{#set: molecular-weight=449.44}}
+{{#set: molecular-weight=283.473}}