Difference between revisions of "SJ00174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldehydes Aldehydes] == * common-name: ** an aldehyde == Reaction(s) known to consume the compo...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * common-name: ** udp-α-d-glucuronate * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldehydes Aldehydes] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
 
* common-name:
 
* common-name:
** an aldehyde
+
** udp-α-d-glucuronate
 +
* smiles:
 +
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
 +
* inchi-key:
 +
** hdyanyhvcapmjv-lxqifkjmsa-k
 +
* molecular-weight:
 +
** 577.265
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+
* [[2.4.1.212-RXN]]
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
+
* [[2.4.1.225-RXN]]
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
+
* [[2.7.7.44-RXN]]
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
+
* [[RXN-10606]]
* [[ALDHDEHYDROG-RXN]]
+
* [[RXN-10607]]
 +
* [[RXN-10608]]
 +
* [[RXN-10609]]
 +
* [[RXN-10616]]
 +
* [[RXN-10617]]
 +
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-9000]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 +
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
* [[UGDC]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
+
* [[2.7.7.44-RXN]]
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
+
* [[UGD-RXN]]
* [[RXN-9598]]
+
* [[UGDH]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an aldehyde}}
+
{{#set: common-name=udp-&alpha;-d-glucuronate}}
 +
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 +
{{#set: molecular-weight=577.265}}

Revision as of 14:20, 26 August 2019

Metabolite UDP-GLUCURONATE

  • common-name:
    • udp-α-d-glucuronate
  • smiles:
    • c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • hdyanyhvcapmjv-lxqifkjmsa-k
  • molecular-weight:
    • 577.265

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality