Difference between revisions of "SJ00230"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] == * common-name: ** pelargonidin-...")
 
(Created page with "Category:gene == Gene SJ00230 == * transcription-direction: ** positive * right-end-position: ** 82938 * left-end-position: ** 73911 * centisome-position: ** 12.973534...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] ==
+
== Gene SJ00230 ==
−
* common-name:
+
* transcription-direction:
−
** pelargonidin-3-o-β-d-glucoside
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
+
** 82938
−
* inchi-key:
+
* left-end-position:
−
** abvcubuixwjyse-gqupqbgvsa-m
+
** 73911
−
* molecular-weight:
+
* centisome-position:
−
** 431.375
+
** 12.973534   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-7828]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[4.2.99.18-RXN]]
−
{{#set: common-name=pelargonidin-3-o-β-d-glucoside}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=431.375}}
+
* [[RXN0-2601]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=82938}}
 +
{{#set: left-end-position=73911}}
 +
{{#set: centisome-position=12.973534    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ00230

  • transcription-direction:
    • positive
  • right-end-position:
    • 82938
  • left-end-position:
    • 73911
  • centisome-position:
    • 12.973534

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ00230&oldid=132066"