Difference between revisions of "SJ00231"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * common-name: ** l-galactono-1,4-lactone * smiles: ** c(o)c(o)[ch]1(c(o)c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15837 CPD-15837] == * common-name: ** β-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15837 CPD-15837] ==
 
* common-name:
 
* common-name:
** l-galactono-1,4-lactone
+
** β-tocotrienol
 
* smiles:
 
* smiles:
** c(o)c(o)[ch]1(c(o)c(o)c(=o)o1)
+
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=cc=2c)o)c)))c)c)c
 
* inchi-key:
 
* inchi-key:
** sxzycxmupbbulw-neewwzblsa-n
+
** fgykufvnyvmtam-wazjvijmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 178.141
+
** 410.639
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.3.12-RXN]]
 
* [[RXN-11153]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1884]]
+
* [[RXN-14919]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-galactono-1,4-lactone}}
+
{{#set: common-name=β-tocotrienol}}
{{#set: inchi-key=inchikey=sxzycxmupbbulw-neewwzblsa-n}}
+
{{#set: inchi-key=inchikey=fgykufvnyvmtam-wazjvijmsa-n}}
{{#set: molecular-weight=178.141}}
+
{{#set: molecular-weight=410.639}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-15837

  • common-name:
    • β-tocotrienol
  • smiles:
    • cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=cc=2c)o)c)))c)c)c
  • inchi-key:
    • fgykufvnyvmtam-wazjvijmsa-n
  • molecular-weight:
    • 410.639

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality