Difference between revisions of "SJ00249"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=c...")
(Created page with "Category:gene == Gene SJ00249 == * transcription-direction: ** negative * right-end-position: ** 566 * left-end-position: ** 35 * centisome-position: ** 4.084014 == Or...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] ==
+
== Gene SJ00249 ==
* common-name:
+
* transcription-direction:
** (2r,3s,4s)-leucodelphinidin
+
** negative
* smiles:
+
* right-end-position:
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
+
** 566
* inchi-key:
+
* left-end-position:
** zeacokjoqlaytd-souvjxgzsa-n
+
** 35
* molecular-weight:
+
* centisome-position:
** 322.271
+
** 4.084014   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-7784]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=322.271}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=566}}
 +
{{#set: left-end-position=35}}
 +
{{#set: centisome-position=4.084014    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ00249

  • transcription-direction:
    • negative
  • right-end-position:
    • 566
  • left-end-position:
    • 35
  • centisome-position:
    • 4.084014

Organism(s) associated with this gene

Reaction(s) associated