Difference between revisions of "SJ00250"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * common-name: ** imidazole acetol-phosphate * smiles...")
(Created page with "Category:gene == Gene SJ12070 == * transcription-direction: ** negative * right-end-position: ** 218701 * left-end-position: ** 215792 * centisome-position: ** 59.583397...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] ==
+
== Gene SJ12070 ==
* common-name:
+
* transcription-direction:
** imidazole acetol-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
+
** 218701
* inchi-key:
+
* left-end-position:
** ycffmsolumramd-uhfffaoysa-l
+
** 215792
* molecular-weight:
+
* centisome-position:
** 218.105
+
** 59.583397   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[HISTAMINOTRANS-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[HISTAMINOTRANS-RXN]]
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
* [[IGPD]]
+
** Category: [[annotation]]
* [[IMIDPHOSDEHYD-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=imidazole acetol-phosphate}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=218.105}}
+
{{#set: right-end-position=218701}}
 +
{{#set: left-end-position=215792}}
 +
{{#set: centisome-position=59.583397    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ12070

  • transcription-direction:
    • negative
  • right-end-position:
    • 218701
  • left-end-position:
    • 215792
  • centisome-position:
    • 59.583397

Organism(s) associated with this gene

Reaction(s) associated