Difference between revisions of "SJ00348"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLCHOLINE ACETYLCHOLINE] == * common-name: ** acetylcholine * smiles: ** cc(=o)occ[n+](c)(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLCHOLINE ACETYLCHOLINE] ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxyphenylglycol
+
** acetylcholine
 
* smiles:
 
* smiles:
** coc1(=c(o)c=cc(c(o)co)=c1)
+
** cc(=o)occ[n+](c)(c)c
 
* inchi-key:
 
* inchi-key:
** fbwpwwwzwkpjfl-qmmmgpobsa-n
+
** oipilfwxsmykgl-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 184.191
+
** 146.209
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10915]]
+
* [[ACETYLCHOLINESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10915]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxyphenylglycol}}
+
{{#set: common-name=acetylcholine}}
{{#set: inchi-key=inchikey=fbwpwwwzwkpjfl-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=oipilfwxsmykgl-uhfffaoysa-n}}
{{#set: molecular-weight=184.191}}
+
{{#set: molecular-weight=146.209}}

Revision as of 14:19, 26 August 2019

Metabolite ACETYLCHOLINE

  • common-name:
    • acetylcholine
  • smiles:
    • cc(=o)occ[n+](c)(c)c
  • inchi-key:
    • oipilfwxsmykgl-uhfffaoysa-n
  • molecular-weight:
    • 146.209

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality