Difference between revisions of "SJ00403"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] == * common-name: ** a 3'-half...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * common-name: ** 3-ethyl-2-oxosuccinate * smiles: ** ccc(c([o-])=o)c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] ==
 
* common-name:
 
* common-name:
** a 3'-half-trna molecule with a 5'-oh end
+
** 3-ethyl-2-oxosuccinate
 +
* smiles:
 +
** ccc(c([o-])=o)c(c(=o)[o-])=o
 +
* inchi-key:
 +
** ouglpihdpbrsid-uhfffaoysa-l
 +
* molecular-weight:
 +
** 158.11
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-18210]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.27.9-RXN]]
+
* [[RXN-18210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3'-half-trna molecule with a 5'-oh end}}
+
{{#set: common-name=3-ethyl-2-oxosuccinate}}
 +
{{#set: inchi-key=inchikey=ouglpihdpbrsid-uhfffaoysa-l}}
 +
{{#set: molecular-weight=158.11}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-19492

  • common-name:
    • 3-ethyl-2-oxosuccinate
  • smiles:
    • ccc(c([o-])=o)c(c(=o)[o-])=o
  • inchi-key:
    • ouglpihdpbrsid-uhfffaoysa-l
  • molecular-weight:
    • 158.11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality