Difference between revisions of "SJ00411"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHOXY-BENZOQUINONE OCTAPRENYL-METHOXY-BENZOQUINONE] == * common-name: ** 2-methoxy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHOXY-BENZOQUINONE OCTAPRENYL-METHOXY-BENZOQUINONE] ==
 
* common-name:
 
* common-name:
** 3-amino-2,3-dideoxy-scyllo-inosose
+
** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** fsugckmutgkwie-ygivhsipsa-o
+
** czfrmaseeptbaq-mycgwmctsa-n
 
* molecular-weight:
 
* molecular-weight:
** 162.165
+
** 685.084
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13118]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
+
{{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
+
{{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}}
{{#set: molecular-weight=162.165}}
+
{{#set: molecular-weight=685.084}}

Revision as of 14:20, 26 August 2019

Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE

  • common-name:
    • 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • czfrmaseeptbaq-mycgwmctsa-n
  • molecular-weight:
    • 685.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality